C23H25F3N2O4S — CID 170199820
N-(6,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)-1-fluoroethanesulfonamide (PubChem CID 170199820) has the molecular formula C23H25F3N2O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is N-(6,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)-1-fluoroethanesulfonamide.
| Compound Name | N-(6,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)-1-fluoroethanesulfonamide |
|---|---|
| PubChem CID | 170199820 |
| Molecular Formula | C23H25F3N2O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-(6,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)-1-fluoroethanesulfonamide |
| SMILES | CC(F)S(=O)(=O)NC1C(F)CCN2C(=O)CCOc3c(F)cccc3-c3cccc(c3)CC12 |
| InChI | InChI=1S/C23H25F3N2O4S/c1-14(24)33(30,31)27-22-18(25)8-10-28-20(22)13-15-4-2-5-16(12-15)17-6-3-7-19(26)23(17)32-11-9-21(28)29/h2-7,12,14,18,20,22,27H,8-11,13H2,1H3 |
| InChIKey | RLRCGXKGFOHXFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |