C22H22F4N2O2S — CID 169174004
16-(difluoromethylsulfanylamino)-4,6-difluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-11-one (PubChem CID 169174004) has the molecular formula C22H22F4N2O2S and a molecular weight of 454.49 g/mol. Its IUPAC name is 16-(difluoromethylsulfanylamino)-4,6-difluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-11-one.
| Compound Name | 16-(difluoromethylsulfanylamino)-4,6-difluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-11-one |
|---|---|
| PubChem CID | 169174004 |
| Molecular Formula | C22H22F4N2O2S |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 16-(difluoromethylsulfanylamino)-4,6-difluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-11-one |
| SMILES | O=C1CCOc2c(F)cc(F)cc2-c2cccc(c2)CC2C(NSC(F)F)CCCN12 |
| InChI | InChI=1S/C22H22F4N2O2S/c23-15-11-16-14-4-1-3-13(9-14)10-19-18(27-31-22(25)26)5-2-7-28(19)20(29)6-8-30-21(16)17(24)12-15/h1,3-4,9,11-12,18-19,22,27H,2,5-8,10H2 |
| InChIKey | YIXFBHFFZQSJBT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|