C22H27N3O4S — CID 169296628
N-[(17R,18R)-12-oxo-8-oxa-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl]methanesulfonamide (PubChem CID 169296628) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[(17R,18R)-12-oxo-8-oxa-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl]methanesulfonamide.
| Compound Name | N-[(17R,18R)-12-oxo-8-oxa-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl]methanesulfonamide |
|---|---|
| PubChem CID | 169296628 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[(17R,18R)-12-oxo-8-oxa-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCCN2C(=O)NCCOc3ccccc3-c3cccc(c3)C[C@H]12 |
| InChI | InChI=1S/C22H27N3O4S/c1-30(27,28)24-19-9-5-12-25-20(19)15-16-6-4-7-17(14-16)18-8-2-3-10-21(18)29-13-11-23-22(25)26/h2-4,6-8,10,14,19-20,24H,5,9,11-13,15H2,1H3,(H,23,26)/t19-,20-/m1/s1 |
| InChIKey | BRVJVUWRKZNUJL-WOJBJXKFSA-N |
| XLogP | 2.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |