C23H27N3O4S — CID 170293109
N-(14-oxo-8-oxa-13,15-diazapentacyclo[19.3.1.02,7.010,13.015,19]pentacosa-1(24),2,4,6,21(25),22-hexaen-18-yl)methanesulfonamide (PubChem CID 170293109) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-(14-oxo-8-oxa-13,15-diazapentacyclo[19.3.1.02,7.010,13.015,19]pentacosa-1(24),2,4,6,21(25),22-hexaen-18-yl)methanesulfonamide.
| Compound Name | N-(14-oxo-8-oxa-13,15-diazapentacyclo[19.3.1.02,7.010,13.015,19]pentacosa-1(24),2,4,6,21(25),22-hexaen-18-yl)methanesulfonamide |
|---|---|
| PubChem CID | 170293109 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-(14-oxo-8-oxa-13,15-diazapentacyclo[19.3.1.02,7.010,13.015,19]pentacosa-1(24),2,4,6,21(25),22-hexaen-18-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN2C(=O)N3CCC3COc3ccccc3-c3cccc(c3)CC12 |
| InChI | InChI=1S/C23H27N3O4S/c1-31(28,29)24-20-10-12-26-21(20)14-16-5-4-6-17(13-16)19-7-2-3-8-22(19)30-15-18-9-11-25(18)23(26)27/h2-8,13,18,20-21,24H,9-12,14-15H2,1H3 |
| InChIKey | RQZNTGRFLQBAPZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |