C22H24F2N2O4S — CID 170199531
1,1-difluoro-N-[(16S,17S)-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]methanesulfonamide (PubChem CID 170199531) has the molecular formula C22H24F2N2O4S and a molecular weight of 450.51 g/mol. Its IUPAC name is 1,1-difluoro-N-[(16S,17S)-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[(16S,17S)-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170199531 |
| Molecular Formula | C22H24F2N2O4S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1,1-difluoro-N-[(16S,17S)-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]methanesulfonamide |
| SMILES | O=C1CCOc2ccccc2-c2cccc(c2)C[C@H]2[C@@H](NS(=O)(=O)C(F)F)CCCN12 |
| InChI | InChI=1S/C22H24F2N2O4S/c23-22(24)31(28,29)25-18-8-4-11-26-19(18)14-15-5-3-6-16(13-15)17-7-1-2-9-20(17)30-12-10-21(26)27/h1-3,5-7,9,13,18-19,22,25H,4,8,10-12,14H2/t18-,19-/m0/s1 |
| InChIKey | ACBVDGJINMKEBA-OALUTQOASA-N |
| XLogP | 3.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |