C25H33N3O3S — CID 169296610
N-(14-oxo-13,15-diazatetracyclo[20.3.1.02,7.015,20]hexacosa-1(25),2,4,6,22(26),23-hexaen-19-yl)methanesulfonamide (PubChem CID 169296610) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is N-(14-oxo-13,15-diazatetracyclo[20.3.1.02,7.015,20]hexacosa-1(25),2,4,6,22(26),23-hexaen-19-yl)methanesulfonamide.
| Compound Name | N-(14-oxo-13,15-diazatetracyclo[20.3.1.02,7.015,20]hexacosa-1(25),2,4,6,22(26),23-hexaen-19-yl)methanesulfonamide |
|---|---|
| PubChem CID | 169296610 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-(14-oxo-13,15-diazatetracyclo[20.3.1.02,7.015,20]hexacosa-1(25),2,4,6,22(26),23-hexaen-19-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCN2C(=O)NCCCCCc3ccccc3-c3cccc(c3)CC12 |
| InChI | InChI=1S/C25H33N3O3S/c1-32(30,31)27-23-14-8-16-28-24(23)18-19-9-7-12-21(17-19)22-13-5-4-11-20(22)10-3-2-6-15-26-25(28)29/h4-5,7,9,11-13,17,23-24,27H,2-3,6,8,10,14-16,18H2,1H3,(H,26,29) |
| InChIKey | ZIEOBIMQRCOLJU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |