C22H27N3O3S — CID 169296685
N-(10-methyl-11-oxo-10,12-diazatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide (PubChem CID 169296685) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-(10-methyl-11-oxo-10,12-diazatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide.
| Compound Name | N-(10-methyl-11-oxo-10,12-diazatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide |
|---|---|
| PubChem CID | 169296685 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-(10-methyl-11-oxo-10,12-diazatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide |
| SMILES | CN1CCc2ccccc2-c2cccc(c2)CC2C(NS(C)(=O)=O)CCN2C1=O |
| InChI | InChI=1S/C22H27N3O3S/c1-24-12-10-17-7-3-4-9-19(17)18-8-5-6-16(14-18)15-21-20(23-29(2,27)28)11-13-25(21)22(24)26/h3-9,14,20-21,23H,10-13,15H2,1-2H3 |
| InChIKey | APMXWANONOYYIT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |