C22H26N2O4S — CID 169296569
N-(12-oxo-11-oxa-13-azatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)methanesulfonamide (PubChem CID 169296569) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(12-oxo-11-oxa-13-azatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)methanesulfonamide.
| Compound Name | N-(12-oxo-11-oxa-13-azatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)methanesulfonamide |
|---|---|
| PubChem CID | 169296569 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-(12-oxo-11-oxa-13-azatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN2C(=O)OCCCc3ccccc3-c3cccc(c3)CC12 |
| InChI | InChI=1S/C22H26N2O4S/c1-29(26,27)23-20-11-12-24-21(20)15-16-6-4-8-18(14-16)19-10-3-2-7-17(19)9-5-13-28-22(24)25/h2-4,6-8,10,14,20-21,23H,5,9,11-13,15H2,1H3 |
| InChIKey | OBLBUZDHWGKBNC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |