C24H31N3O3S — CID 169296749
N-(11-methyl-12-oxo-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl)methanesulfonamide (PubChem CID 169296749) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-(11-methyl-12-oxo-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl)methanesulfonamide.
| Compound Name | N-(11-methyl-12-oxo-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl)methanesulfonamide |
|---|---|
| PubChem CID | 169296749 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-(11-methyl-12-oxo-11,13-diazatetracyclo[18.3.1.02,7.013,18]tetracosa-1(23),2,4,6,20(24),21-hexaen-17-yl)methanesulfonamide |
| SMILES | CN1CCCc2ccccc2-c2cccc(c2)CC2C(NS(C)(=O)=O)CCCN2C1=O |
| InChI | InChI=1S/C24H31N3O3S/c1-26-14-6-11-19-9-3-4-12-21(19)20-10-5-8-18(16-20)17-23-22(25-31(2,29)30)13-7-15-27(23)24(26)28/h3-5,8-10,12,16,22-23,25H,6-7,11,13-15,17H2,1-2H3 |
| InChIKey | WGXMCEHZWVTGSY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |