C21H19F5N2O4S — CID 170199942
1,1-difluoro-N-(14,14,22-trifluoro-11-oxo-8-oxa-12-azatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide (PubChem CID 170199942) has the molecular formula C21H19F5N2O4S and a molecular weight of 490.45 g/mol. Its IUPAC name is 1,1-difluoro-N-(14,14,22-trifluoro-11-oxo-8-oxa-12-azatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide.
| Compound Name | 1,1-difluoro-N-(14,14,22-trifluoro-11-oxo-8-oxa-12-azatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide |
|---|---|
| PubChem CID | 170199942 |
| Molecular Formula | C21H19F5N2O4S |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 1,1-difluoro-N-(14,14,22-trifluoro-11-oxo-8-oxa-12-azatetracyclo[16.3.1.02,7.012,16]docosa-1(21),2,4,6,18(22),19-hexaen-15-yl)methanesulfonamide |
| SMILES | O=C1CCOc2ccccc2-c2cccc(c2F)CC2C(NS(=O)(=O)C(F)F)C(F)(F)CN12 |
| InChI | InChI=1S/C21H19F5N2O4S/c22-18-12-4-3-6-14(18)13-5-1-2-7-16(13)32-9-8-17(29)28-11-21(25,26)19(15(28)10-12)27-33(30,31)20(23)24/h1-7,15,19-20,27H,8-11H2 |
| InChIKey | QNUHUZYBTHBTKU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |