C25H30FN3O2S — CID 169174032
16-(ethylsulfanylamino)-23-fluoro-11-methylspiro[8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaene-15,1'-cyclopropane]-12-one (PubChem CID 169174032) has the molecular formula C25H30FN3O2S and a molecular weight of 455.60 g/mol. Its IUPAC name is 16-(ethylsulfanylamino)-23-fluoro-11-methylspiro[8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaene-15,1'-cyclopropane]-12-one.
| Compound Name | 16-(ethylsulfanylamino)-23-fluoro-11-methylspiro[8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaene-15,1'-cyclopropane]-12-one |
|---|---|
| PubChem CID | 169174032 |
| Molecular Formula | C25H30FN3O2S |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 16-(ethylsulfanylamino)-23-fluoro-11-methylspiro[8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaene-15,1'-cyclopropane]-12-one |
| SMILES | CCSNC1C2Cc3cccc(c3F)-c3ccccc3OCCN(C)C(=O)N2CC12CC2 |
| InChI | InChI=1S/C25H30FN3O2S/c1-3-32-27-23-20-15-17-7-6-9-19(22(17)26)18-8-4-5-10-21(18)31-14-13-28(2)24(30)29(20)16-25(23)11-12-25/h4-10,20,23,27H,3,11-16H2,1-2H3 |
| InChIKey | YMCNGSXWNZJVMU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|