C22H24F2N2O2 — CID 170199748
15,23-difluoro-11,16-dimethyl-8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-12-one (PubChem CID 170199748) has the molecular formula C22H24F2N2O2 and a molecular weight of 386.44 g/mol. Its IUPAC name is 15,23-difluoro-11,16-dimethyl-8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-12-one.
| Compound Name | 15,23-difluoro-11,16-dimethyl-8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-12-one |
|---|---|
| PubChem CID | 170199748 |
| Molecular Formula | C22H24F2N2O2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 15,23-difluoro-11,16-dimethyl-8-oxa-11,13-diazatetracyclo[17.3.1.02,7.013,17]tricosa-1(22),2,4,6,19(23),20-hexaen-12-one |
| SMILES | CC1C(F)CN2C(=O)N(C)CCOc3ccccc3-c3cccc(c3F)CC12 |
| InChI | InChI=1S/C22H24F2N2O2/c1-14-18(23)13-26-19(14)12-15-6-5-8-17(21(15)24)16-7-3-4-9-20(16)28-11-10-25(2)22(26)27/h3-9,14,18-19H,10-13H2,1-2H3 |
| InChIKey | BJIXTJRCNVHLDX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |