C23H27F3N2OS — CID 169173979
(17R)-21,23-difluoro-11-methylidene-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaene;S-(fluoromethyl)thiohydroxylamine (PubChem CID 169173979) has the molecular formula C23H27F3N2OS and a molecular weight of 436.54 g/mol. Its IUPAC name is (17R)-21,23-difluoro-11-methylidene-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaene;S-(fluoromethyl)thiohydroxylamine.
| Compound Name | (17R)-21,23-difluoro-11-methylidene-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaene;S-(fluoromethyl)thiohydroxylamine |
|---|---|
| PubChem CID | 169173979 |
| Molecular Formula | C23H27F3N2OS |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (17R)-21,23-difluoro-11-methylidene-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaene;S-(fluoromethyl)thiohydroxylamine |
| SMILES | C=C1CCOc2ccccc2-c2cc(F)cc(c2F)C[C@H]2CCCCN12.NSCF |
| InChI | InChI=1S/C22H23F2NO.CH4FNS/c1-15-9-11-26-21-8-3-2-7-19(21)20-14-17(23)12-16(22(20)24)13-18-6-4-5-10-25(15)18;2-1-4-3/h2-3,7-8,12,14,18H,1,4-6,9-11,13H2;1,3H2/t18-;/m1./s1 |
| InChIKey | KYIULHSKODJYKY-GMUIIQOCSA-N |
| XLogP | 5.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|