C25H32FN3O3 — CID 175657973
(17S,18S)-12-[(5-fluoro-2-pyridinyl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.4.0.03,8]henicosa-3,5,7-trien-2-one (PubChem CID 175657973) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is (17S,18S)-12-[(5-fluoro-2-pyridinyl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.4.0.03,8]henicosa-3,5,7-trien-2-one.
| Compound Name | (17S,18S)-12-[(5-fluoro-2-pyridinyl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.4.0.03,8]henicosa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 175657973 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (17S,18S)-12-[(5-fluoro-2-pyridinyl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.4.0.03,8]henicosa-3,5,7-trien-2-one |
| SMILES | CO[C@H]1CCCN2C(=O)c3ccccc3OCCN(Cc3ccc(F)cn3)CCCC[C@@H]12 |
| InChI | InChI=1S/C25H32FN3O3/c1-31-24-10-6-14-29-22(24)8-4-5-13-28(18-20-12-11-19(26)17-27-20)15-16-32-23-9-3-2-7-21(23)25(29)30/h2-3,7,9,11-12,17,22,24H,4-6,8,10,13-16,18H2,1H3/t22-,24-/m0/s1 |
| InChIKey | VWFVEZVWFABXLU-UPVQGACJSA-N |
| XLogP | 3.91 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |