C25H36N4O3 — CID 171689151
(17R,18S)-12-[(1,5-dimethylpyrazol-4-yl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.3.1.03,8]henicosa-3,5,7-trien-2-one (PubChem CID 171689151) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is (17R,18S)-12-[(1,5-dimethylpyrazol-4-yl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.3.1.03,8]henicosa-3,5,7-trien-2-one.
| Compound Name | (17R,18S)-12-[(1,5-dimethylpyrazol-4-yl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.3.1.03,8]henicosa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 171689151 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (17R,18S)-12-[(1,5-dimethylpyrazol-4-yl)methyl]-18-methoxy-9-oxa-1,12-diazatricyclo[15.3.1.03,8]henicosa-3,5,7-trien-2-one |
| SMILES | CO[C@H]1CCN2C[C@H]1CCCCN(Cc1cnn(C)c1C)CCOc1ccccc1C2=O |
| InChI | InChI=1S/C25H36N4O3/c1-19-21(16-26-27(19)2)17-28-12-7-6-8-20-18-29(13-11-23(20)31-3)25(30)22-9-4-5-10-24(22)32-15-14-28/h4-5,9-10,16,20,23H,6-8,11-15,17-18H2,1-3H3/t20-,23+/m1/s1 |
| InChIKey | LNAGUOPYTGSCRW-OFNKIYASSA-N |
| XLogP | 3.27 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |