C27H40N4O3 — CID 171689160
(16R,17S)-11-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one (PubChem CID 171689160) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (16R,17S)-11-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one.
| Compound Name | (16R,17S)-11-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one |
|---|---|
| PubChem CID | 171689160 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (16R,17S)-11-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-17-methoxy-8-oxa-1,11-diazatricyclo[14.3.1.13,7]henicosa-3(21),4,6-trien-2-one |
| SMILES | CCn1nc(C)c(CN2CCCC[C@@H]3CN(CC[C@@H]3OC)C(=O)c3cccc(c3)OCC2)c1C |
| InChI | InChI=1S/C27H40N4O3/c1-5-31-21(3)25(20(2)28-31)19-29-13-7-6-9-23-18-30(14-12-26(23)33-4)27(32)22-10-8-11-24(17-22)34-16-15-29/h8,10-11,17,23,26H,5-7,9,12-16,18-19H2,1-4H3/t23-,26+/m1/s1 |
| InChIKey | JYTCYTZXJNNXRO-BVAGGSTKSA-N |
| XLogP | 4.06 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |