C23H31N3O3S — CID 171689167
(7S,8S)-7-methoxy-13-(1,3-thiazol-4-ylmethyl)-16-oxa-3,13-diazatricyclo[15.3.1.03,8]henicosa-1(21),17,19-trien-2-one (PubChem CID 171689167) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is (7S,8S)-7-methoxy-13-(1,3-thiazol-4-ylmethyl)-16-oxa-3,13-diazatricyclo[15.3.1.03,8]henicosa-1(21),17,19-trien-2-one.
| Compound Name | (7S,8S)-7-methoxy-13-(1,3-thiazol-4-ylmethyl)-16-oxa-3,13-diazatricyclo[15.3.1.03,8]henicosa-1(21),17,19-trien-2-one |
|---|---|
| PubChem CID | 171689167 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (7S,8S)-7-methoxy-13-(1,3-thiazol-4-ylmethyl)-16-oxa-3,13-diazatricyclo[15.3.1.03,8]henicosa-1(21),17,19-trien-2-one |
| SMILES | CO[C@H]1CCCN2C(=O)c3cccc(c3)OCCN(Cc3cscn3)CCCC[C@@H]12 |
| InChI | InChI=1S/C23H31N3O3S/c1-28-22-9-5-11-26-21(22)8-2-3-10-25(15-19-16-30-17-24-19)12-13-29-20-7-4-6-18(14-20)23(26)27/h4,6-7,14,16-17,21-22H,2-3,5,8-13,15H2,1H3/t21-,22-/m0/s1 |
| InChIKey | FDRMBFMUSLXLIQ-VXKWHMMOSA-N |
| XLogP | 3.83 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |