C28H32N4O5S — CID 131918559
(10S,15S)-25-methoxy-13-(1,3-thiazol-4-ylmethyl)-2,9-dioxa-13,16,21-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione (PubChem CID 131918559) has the molecular formula C28H32N4O5S and a molecular weight of 536.65 g/mol. Its IUPAC name is (10S,15S)-25-methoxy-13-(1,3-thiazol-4-ylmethyl)-2,9-dioxa-13,16,21-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione.
| Compound Name | (10S,15S)-25-methoxy-13-(1,3-thiazol-4-ylmethyl)-2,9-dioxa-13,16,21-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
|---|---|
| PubChem CID | 131918559 |
| Molecular Formula | C28H32N4O5S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (10S,15S)-25-methoxy-13-(1,3-thiazol-4-ylmethyl)-2,9-dioxa-13,16,21-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
| SMILES | COc1cc2cc(c1)C(=O)NCCCC(=O)N[C@H]1CN(Cc3cscn3)CC[C@@H]1OCc1cccc(c1)O2 |
| InChI | InChI=1S/C28H32N4O5S/c1-35-23-11-20-12-24(13-23)37-22-5-2-4-19(10-22)16-36-26-7-9-32(14-21-17-38-18-30-21)15-25(26)31-27(33)6-3-8-29-28(20)34/h2,4-5,10-13,17-18,25-26H,3,6-9,14-16H2,1H3,(H,29,34)(H,31,33)/t25-,26-/m0/s1 |
| InChIKey | LQYBLTCJHBXRBU-UIOOFZCWSA-N |
| XLogP | 3.74 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |