C29H35N5O6S — CID 131898187
(10S,15S)-25-(2-methoxyethoxy)-12-(1,3-thiazol-2-ylmethyl)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione (PubChem CID 131898187) has the molecular formula C29H35N5O6S and a molecular weight of 581.70 g/mol. Its IUPAC name is (10S,15S)-25-(2-methoxyethoxy)-12-(1,3-thiazol-2-ylmethyl)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione.
| Compound Name | (10S,15S)-25-(2-methoxyethoxy)-12-(1,3-thiazol-2-ylmethyl)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
|---|---|
| PubChem CID | 131898187 |
| Molecular Formula | C29H35N5O6S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | (10S,15S)-25-(2-methoxyethoxy)-12-(1,3-thiazol-2-ylmethyl)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
| SMILES | COCCOc1cc2cc(c1)C(=O)NCCNC(=O)N[C@H]1CCN(Cc3nccs3)C[C@@H]1OCc1cccc(c1)O2 |
| InChI | InChI=1S/C29H35N5O6S/c1-37-10-11-38-23-14-21-15-24(16-23)40-22-4-2-3-20(13-22)19-39-26-17-34(18-27-30-8-12-41-27)9-5-25(26)33-29(36)32-7-6-31-28(21)35/h2-4,8,12-16,25-26H,5-7,9-11,17-19H2,1H3,(H,31,35)(H2,32,33,36)/t25-,26-/m0/s1 |
| InChIKey | DIXYJWQODZARTC-UIOOFZCWSA-N |
| XLogP | 3.16 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|