C33H39FN4O7 — CID 131894275
(10S,15S)-12-[(3-fluoro-2-methoxyphenyl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione (PubChem CID 131894275) has the molecular formula C33H39FN4O7 and a molecular weight of 622.69 g/mol. Its IUPAC name is (10S,15S)-12-[(3-fluoro-2-methoxyphenyl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione.
| Compound Name | (10S,15S)-12-[(3-fluoro-2-methoxyphenyl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
|---|---|
| PubChem CID | 131894275 |
| Molecular Formula | C33H39FN4O7 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | (10S,15S)-12-[(3-fluoro-2-methoxyphenyl)methyl]-25-(2-methoxyethoxy)-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,22-dione |
| SMILES | COCCOc1cc2cc(c1)C(=O)NCCNC(=O)N[C@H]1CCN(Cc3cccc(F)c3OC)C[C@@H]1OCc1cccc(c1)O2 |
| InChI | InChI=1S/C33H39FN4O7/c1-41-13-14-43-26-16-24-17-27(18-26)45-25-7-3-5-22(15-25)21-44-30-20-38(19-23-6-4-8-28(34)31(23)42-2)12-9-29(30)37-33(40)36-11-10-35-32(24)39/h3-8,15-18,29-30H,9-14,19-21H2,1-2H3,(H,35,39)(H2,36,37,40)/t29-,30-/m0/s1 |
| InChIKey | PRLHEWYSTIHMRC-KYJUHHDHSA-N |
| XLogP | 3.85 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|