C30H40N6O8 — CID 131919420
3-[2-[(10S,15S)-25-(2-methoxyethoxy)-17,22-dioxo-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaen-12-yl]-2-oxoethyl]-1,1-dimethylurea (PubChem CID 131919420) has the molecular formula C30H40N6O8 and a molecular weight of 612.68 g/mol. Its IUPAC name is 3-[2-[(10S,15S)-25-(2-methoxyethoxy)-17,22-dioxo-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaen-12-yl]-2-oxoethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(10S,15S)-25-(2-methoxyethoxy)-17,22-dioxo-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaen-12-yl]-2-oxoethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 131919420 |
| Molecular Formula | C30H40N6O8 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | 3-[2-[(10S,15S)-25-(2-methoxyethoxy)-17,22-dioxo-2,9-dioxa-12,16,18,21-tetrazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaen-12-yl]-2-oxoethyl]-1,1-dimethylurea |
| SMILES | COCCOc1cc2cc(c1)C(=O)NCCNC(=O)N[C@H]1CCN(C(=O)CNC(=O)N(C)C)C[C@@H]1OCc1cccc(c1)O2 |
| InChI | InChI=1S/C30H40N6O8/c1-35(2)30(40)33-17-27(37)36-10-7-25-26(18-36)43-19-20-5-4-6-22(13-20)44-24-15-21(14-23(16-24)42-12-11-41-3)28(38)31-8-9-32-29(39)34-25/h4-6,13-16,25-26H,7-12,17-19H2,1-3H3,(H,31,38)(H,33,40)(H2,32,34,39)/t25-,26-/m0/s1 |
| InChIKey | NMAKOQHHTMGTHX-UIOOFZCWSA-N |
| XLogP | 1.30 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|