C34H41N7O5 — CID 163341881
(2S,6R)-4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-10-(quinoxaline-2-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one;formic acid (PubChem CID 163341881) has the molecular formula C34H41N7O5 and a molecular weight of 627.75 g/mol. Its IUPAC name is (2S,6R)-4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-10-(quinoxaline-2-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one;formic acid.
| Compound Name | (2S,6R)-4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-10-(quinoxaline-2-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one;formic acid |
|---|---|
| PubChem CID | 163341881 |
| Molecular Formula | C34H41N7O5 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | (2S,6R)-4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-10-(quinoxaline-2-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one;formic acid |
| SMILES | CCn1nc(C)c(CN2C[C@@H]3NC(=O)CN(C(=O)c4cnc5ccccc5n4)CCCCOc4cccc(c4)[C@H]3C2)c1C.O=CO |
| InChI | InChI=1S/C33H39N7O3.CH2O2/c1-4-40-23(3)26(22(2)37-40)18-38-19-27-24-10-9-11-25(16-24)43-15-8-7-14-39(21-32(41)36-31(27)20-38)33(42)30-17-34-28-12-5-6-13-29(28)35-30;2-1-3/h5-6,9-13,16-17,27,31H,4,7-8,14-15,18-21H2,1-3H3,(H,36,41);1H,(H,2,3)/t27-,31+;/m1./s1 |
| InChIKey | ILBXGFQVXCIJDI-QPPHJREVSA-N |
| XLogP | 3.56 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|