C29H34N6O4 — CID 157016478
(2S,6R)-4-(pyrazine-2-carbonyl)-10-(1,2,5-trimethylpyrrole-3-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one (PubChem CID 157016478) has the molecular formula C29H34N6O4 and a molecular weight of 530.63 g/mol. Its IUPAC name is (2S,6R)-4-(pyrazine-2-carbonyl)-10-(1,2,5-trimethylpyrrole-3-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one.
| Compound Name | (2S,6R)-4-(pyrazine-2-carbonyl)-10-(1,2,5-trimethylpyrrole-3-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
|---|---|
| PubChem CID | 157016478 |
| Molecular Formula | C29H34N6O4 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (2S,6R)-4-(pyrazine-2-carbonyl)-10-(1,2,5-trimethylpyrrole-3-carbonyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
| SMILES | Cc1cc(C(=O)N2CCCCOc3cccc(c3)[C@H]3CN(C(=O)c4cnccn4)C[C@@H]3NC(=O)C2)c(C)n1C |
| InChI | InChI=1S/C29H34N6O4/c1-19-13-23(20(2)33(19)3)28(37)34-11-4-5-12-39-22-8-6-7-21(14-22)24-16-35(17-26(24)32-27(36)18-34)29(38)25-15-30-9-10-31-25/h6-10,13-15,24,26H,4-5,11-12,16-18H2,1-3H3,(H,32,36)/t24-,26+/m1/s1 |
| InChIKey | KIFYUEUPDQGHFW-RSXGOPAZSA-N |
| XLogP | 2.47 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |