C34H41N3O6 — CID 164693891
(2S,6R)-10-[[3-(2-hydroxyethoxy)phenyl]methyl]-4-[2-(2-methoxyphenyl)acetyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one (PubChem CID 164693891) has the molecular formula C34H41N3O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is (2S,6R)-10-[[3-(2-hydroxyethoxy)phenyl]methyl]-4-[2-(2-methoxyphenyl)acetyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one.
| Compound Name | (2S,6R)-10-[[3-(2-hydroxyethoxy)phenyl]methyl]-4-[2-(2-methoxyphenyl)acetyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
|---|---|
| PubChem CID | 164693891 |
| Molecular Formula | C34H41N3O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | (2S,6R)-10-[[3-(2-hydroxyethoxy)phenyl]methyl]-4-[2-(2-methoxyphenyl)acetyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
| SMILES | COc1ccccc1CC(=O)N1C[C@@H]2NC(=O)CN(Cc3cccc(OCCO)c3)CCCCOc3cccc(c3)[C@H]2C1 |
| InChI | InChI=1S/C34H41N3O6/c1-41-32-13-3-2-9-27(32)20-34(40)37-22-30-26-10-7-12-29(19-26)42-16-5-4-14-36(24-33(39)35-31(30)23-37)21-25-8-6-11-28(18-25)43-17-15-38/h2-3,6-13,18-19,30-31,38H,4-5,14-17,20-24H2,1H3,(H,35,39)/t30-,31+/m1/s1 |
| InChIKey | OFLKJYXDZIOFIQ-JSOSNVBQSA-N |
| XLogP | 3.39 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |