C33H34N4O3 — CID 171153491
3-[[(2S,6R)-8-oxo-4-(3-phenylprop-2-enoyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-10-yl]methyl]benzonitrile (PubChem CID 171153491) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 3-[[(2S,6R)-8-oxo-4-(3-phenylprop-2-enoyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-10-yl]methyl]benzonitrile.
| Compound Name | 3-[[(2S,6R)-8-oxo-4-(3-phenylprop-2-enoyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-10-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 171153491 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 3-[[(2S,6R)-8-oxo-4-(3-phenylprop-2-enoyl)-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-10-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCCCOc3cccc(c3)[C@H]3CN(C(=O)C=Cc4ccccc4)C[C@@H]3NC(=O)C2)c1 |
| InChI | InChI=1S/C33H34N4O3/c34-20-26-10-6-11-27(18-26)21-36-16-4-5-17-40-29-13-7-12-28(19-29)30-22-37(23-31(30)35-32(38)24-36)33(39)15-14-25-8-2-1-3-9-25/h1-3,6-15,18-19,30-31H,4-5,16-17,21-24H2,(H,35,38)/t30-,31+/m1/s1 |
| InChIKey | PIHSCXWQWYWNHJ-JSOSNVBQSA-N |
| XLogP | 4.36 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|