C35H40N4O6 — CID 166600249
acetic acid;(2S,6R)-11-[(E)-3-phenylprop-2-enoyl]-4-(3-pyridin-3-ylpropanoyl)-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 166600249) has the molecular formula C35H40N4O6 and a molecular weight of 612.73 g/mol. Its IUPAC name is acetic acid;(2S,6R)-11-[(E)-3-phenylprop-2-enoyl]-4-(3-pyridin-3-ylpropanoyl)-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | acetic acid;(2S,6R)-11-[(E)-3-phenylprop-2-enoyl]-4-(3-pyridin-3-ylpropanoyl)-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 166600249 |
| Molecular Formula | C35H40N4O6 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | acetic acid;(2S,6R)-11-[(E)-3-phenylprop-2-enoyl]-4-(3-pyridin-3-ylpropanoyl)-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | CC(=O)O.O=C1NCCN(C(=O)/C=C/c2ccccc2)CCCOc2cccc(c2)[C@H]2CN(C(=O)CCc3cccnc3)C[C@H]12 |
| InChI | InChI=1S/C33H36N4O4.C2H4O2/c38-31(14-12-25-7-2-1-3-8-25)36-18-6-20-41-28-11-4-10-27(21-28)29-23-37(24-30(29)33(40)35-17-19-36)32(39)15-13-26-9-5-16-34-22-26;1-2(3)4/h1-5,7-12,14,16,21-22,29-30H,6,13,15,17-20,23-24H2,(H,35,40);1H3,(H,3,4)/b14-12+;/t29-,30+;/m1./s1 |
| InChIKey | QZTUVOQSFZUTQR-ZDXMCGNISA-N |
| XLogP | 3.79 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|