C34H33N3O5 — CID 155918704
(2S,6R)-4-(1-benzofuran-2-carbonyl)-12-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 155918704) has the molecular formula C34H33N3O5 and a molecular weight of 563.65 g/mol. Its IUPAC name is (2S,6R)-4-(1-benzofuran-2-carbonyl)-12-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | (2S,6R)-4-(1-benzofuran-2-carbonyl)-12-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 155918704 |
| Molecular Formula | C34H33N3O5 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | (2S,6R)-4-(1-benzofuran-2-carbonyl)-12-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | O=C1NCCCN(C(=O)/C=C/c2ccccc2)CCOc2cccc(c2)[C@H]2CN(C(=O)c3cc4ccccc4o3)C[C@H]12 |
| InChI | InChI=1S/C34H33N3O5/c38-32(15-14-24-8-2-1-3-9-24)36-17-7-16-35-33(39)29-23-37(34(40)31-21-26-10-4-5-13-30(26)42-31)22-28(29)25-11-6-12-27(20-25)41-19-18-36/h1-6,8-15,20-21,28-29H,7,16-19,22-23H2,(H,35,39)/b15-14+/t28-,29+/m1/s1 |
| InChIKey | PDQUPOOKXRTRKP-CDYWHHJPSA-N |
| XLogP | 4.73 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|