C35H37N5O5 — CID 156584816
(2S,6R)-17-methoxy-12-(1-methylindazole-3-carbonyl)-4-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 156584816) has the molecular formula C35H37N5O5 and a molecular weight of 607.71 g/mol. Its IUPAC name is (2S,6R)-17-methoxy-12-(1-methylindazole-3-carbonyl)-4-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | (2S,6R)-17-methoxy-12-(1-methylindazole-3-carbonyl)-4-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 156584816 |
| Molecular Formula | C35H37N5O5 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | (2S,6R)-17-methoxy-12-(1-methylindazole-3-carbonyl)-4-[(E)-3-phenylprop-2-enoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | COc1ccc2cc1OCCN(C(=O)c1nn(C)c3ccccc13)CCCNC(=O)[C@H]1CN(C(=O)/C=C/c3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C35H37N5O5/c1-38-29-12-7-6-11-26(29)33(37-38)35(43)39-18-8-17-36-34(42)28-23-40(32(41)16-13-24-9-4-3-5-10-24)22-27(28)25-14-15-30(44-2)31(21-25)45-20-19-39/h3-7,9-16,21,27-28H,8,17-20,22-23H2,1-2H3,(H,36,42)/b16-13+/t27-,28+/m1/s1 |
| InChIKey | DQHRPSRVSRJQIK-FZGADZDUSA-N |
| XLogP | 3.88 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|