C33H34ClN3O7 — CID 155914344
(2S,6R)-12-(1,3-benzodioxole-5-carbonyl)-4-[2-(4-chlorophenyl)acetyl]-17-methoxy-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 155914344) has the molecular formula C33H34ClN3O7 and a molecular weight of 620.10 g/mol. Its IUPAC name is (2S,6R)-12-(1,3-benzodioxole-5-carbonyl)-4-[2-(4-chlorophenyl)acetyl]-17-methoxy-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | (2S,6R)-12-(1,3-benzodioxole-5-carbonyl)-4-[2-(4-chlorophenyl)acetyl]-17-methoxy-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 155914344 |
| Molecular Formula | C33H34ClN3O7 |
| Molecular Weight | 620.10 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | (2S,6R)-12-(1,3-benzodioxole-5-carbonyl)-4-[2-(4-chlorophenyl)acetyl]-17-methoxy-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | COc1ccc2cc1OCCN(C(=O)c1ccc3c(c1)OCO3)CCCNC(=O)[C@H]1CN(C(=O)Cc3ccc(Cl)cc3)C[C@H]21 |
| InChI | InChI=1S/C33H34ClN3O7/c1-41-27-9-5-22-16-29(27)42-14-13-36(33(40)23-6-10-28-30(17-23)44-20-43-28)12-2-11-35-32(39)26-19-37(18-25(22)26)31(38)15-21-3-7-24(34)8-4-21/h3-10,16-17,25-26H,2,11-15,18-20H2,1H3,(H,35,39)/t25-,26+/m1/s1 |
| InChIKey | ZLEZMZJPRPSXGK-FTJBHMTQSA-N |
| XLogP | 3.90 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.10 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |