C31H38N6O7 — CID 155914788
3-[2-[(2S,6R)-4-[3-(dimethylamino)benzoyl]-17-methoxy-7-oxo-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-12-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 155914788) has the molecular formula C31H38N6O7 and a molecular weight of 606.68 g/mol. Its IUPAC name is 3-[2-[(2S,6R)-4-[3-(dimethylamino)benzoyl]-17-methoxy-7-oxo-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-12-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[(2S,6R)-4-[3-(dimethylamino)benzoyl]-17-methoxy-7-oxo-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-12-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 155914788 |
| Molecular Formula | C31H38N6O7 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 3-[2-[(2S,6R)-4-[3-(dimethylamino)benzoyl]-17-methoxy-7-oxo-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-12-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cc1OCCN(C(=O)CN1C(=O)CNC1=O)CCCNC(=O)[C@H]1CN(C(=O)c3cccc(N(C)C)c3)C[C@H]21 |
| InChI | InChI=1S/C31H38N6O7/c1-34(2)22-7-4-6-21(14-22)30(41)36-17-23-20-8-9-25(43-3)26(15-20)44-13-12-35(11-5-10-32-29(40)24(23)18-36)28(39)19-37-27(38)16-33-31(37)42/h4,6-9,14-15,23-24H,5,10-13,16-19H2,1-3H3,(H,32,40)(H,33,42)/t23-,24+/m1/s1 |
| InChIKey | GEXXBXKXAKASHG-RPWUZVMVSA-N |
| XLogP | 0.90 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|