C29H37N7O7S — CID 155971559
formic acid;(2S,6R)-17-methoxy-12-(4-methyl-1,3-thiazole-5-carbonyl)-4-[4-(1,2,4-triazol-1-yl)butanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 155971559) has the molecular formula C29H37N7O7S and a molecular weight of 627.72 g/mol. Its IUPAC name is formic acid;(2S,6R)-17-methoxy-12-(4-methyl-1,3-thiazole-5-carbonyl)-4-[4-(1,2,4-triazol-1-yl)butanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | formic acid;(2S,6R)-17-methoxy-12-(4-methyl-1,3-thiazole-5-carbonyl)-4-[4-(1,2,4-triazol-1-yl)butanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 155971559 |
| Molecular Formula | C29H37N7O7S |
| Molecular Weight | 627.72 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | formic acid;(2S,6R)-17-methoxy-12-(4-methyl-1,3-thiazole-5-carbonyl)-4-[4-(1,2,4-triazol-1-yl)butanoyl]-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | COc1ccc2cc1OCCN(C(=O)c1scnc1C)CCCNC(=O)[C@H]1CN(C(=O)CCCn3cncn3)C[C@H]21.O=CO |
| InChI | InChI=1S/C28H35N7O5S.CH2O2/c1-19-26(41-18-31-19)28(38)33-9-4-8-30-27(37)22-15-34(25(36)5-3-10-35-17-29-16-32-35)14-21(22)20-6-7-23(39-2)24(13-20)40-12-11-33;2-1-3/h6-7,13,16-18,21-22H,3-5,8-12,14-15H2,1-2H3,(H,30,37);1H,(H,2,3)/t21-,22+;/m1./s1 |
| InChIKey | SWLBULBYXWZMNQ-NSLUPJTDSA-N |
| XLogP | 1.82 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|