C34H35N5O4 — CID 171152150
(2S,6R)-12-(2-indazol-1-ylacetyl)-4-(3-phenylprop-2-enoyl)-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 171152150) has the molecular formula C34H35N5O4 and a molecular weight of 577.69 g/mol. Its IUPAC name is (2S,6R)-12-(2-indazol-1-ylacetyl)-4-(3-phenylprop-2-enoyl)-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | (2S,6R)-12-(2-indazol-1-ylacetyl)-4-(3-phenylprop-2-enoyl)-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 171152150 |
| Molecular Formula | C34H35N5O4 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | (2S,6R)-12-(2-indazol-1-ylacetyl)-4-(3-phenylprop-2-enoyl)-15-oxa-4,8,12-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | O=C1NCCCN(C(=O)Cn2ncc3ccccc32)CCOc2cccc(c2)[C@H]2CN(C(=O)C=Cc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C34H35N5O4/c40-32(15-14-25-8-2-1-3-9-25)38-22-29-26-11-6-12-28(20-26)43-19-18-37(17-7-16-35-34(42)30(29)23-38)33(41)24-39-31-13-5-4-10-27(31)21-36-39/h1-6,8-15,20-21,29-30H,7,16-19,22-24H2,(H,35,42)/t29-,30+/m1/s1 |
| InChIKey | MDSLFVHSIDHIMQ-IHLOFXLRSA-N |
| XLogP | 3.72 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|