C33H36N4O5 — CID 155916559
(2S,6R)-4-(1-benzofuran-2-ylmethyl)-11-[3-(2-oxo-1-pyridinyl)propanoyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 155916559) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is (2S,6R)-4-(1-benzofuran-2-ylmethyl)-11-[3-(2-oxo-1-pyridinyl)propanoyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | (2S,6R)-4-(1-benzofuran-2-ylmethyl)-11-[3-(2-oxo-1-pyridinyl)propanoyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 155916559 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | (2S,6R)-4-(1-benzofuran-2-ylmethyl)-11-[3-(2-oxo-1-pyridinyl)propanoyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | O=C1NCCN(C(=O)CCn2ccccc2=O)CCCOc2cccc(c2)[C@H]2CN(Cc3cc4ccccc4o3)C[C@H]12 |
| InChI | InChI=1S/C33H36N4O5/c38-31-11-3-4-14-36(31)16-12-32(39)37-15-6-18-41-26-9-5-8-24(19-26)28-22-35(23-29(28)33(40)34-13-17-37)21-27-20-25-7-1-2-10-30(25)42-27/h1-5,7-11,14,19-20,28-29H,6,12-13,15-18,21-23H2,(H,34,40)/t28-,29+/m1/s1 |
| InChIKey | GLSVIRWHRAODAF-WDYNHAJCSA-N |
| XLogP | 3.63 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |