C30H38N6O4S — CID 157016846
(2S,6R)-11-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one (PubChem CID 157016846) has the molecular formula C30H38N6O4S and a molecular weight of 578.74 g/mol. Its IUPAC name is (2S,6R)-11-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one.
| Compound Name | (2S,6R)-11-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
|---|---|
| PubChem CID | 157016846 |
| Molecular Formula | C30H38N6O4S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | (2S,6R)-11-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]-15-oxa-4,8,11-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-7-one |
| SMILES | Cc1cc(C)n(CCC(=O)N2CCCOc3cccc(c3)[C@H]3CN(C(=O)Cc4csc(C)n4)C[C@@H]3C(=O)NCC2)n1 |
| InChI | InChI=1S/C30H38N6O4S/c1-20-14-21(2)36(33-20)11-8-28(37)34-10-5-13-40-25-7-4-6-23(15-25)26-17-35(18-27(26)30(39)31-9-12-34)29(38)16-24-19-41-22(3)32-24/h4,6-7,14-15,19,26-27H,5,8-13,16-18H2,1-3H3,(H,31,39)/t26-,27+/m1/s1 |
| InChIKey | YCFABNUWSPJLGT-SXOMAYOGSA-N |
| XLogP | 2.87 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |