C20H16N2O3 — CID 68917235
3-[(E)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-oxoprop-1-enyl]benzonitrile (PubChem CID 68917235) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[(E)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-oxoprop-1-enyl]benzonitrile.
| Compound Name | 3-[(E)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-oxoprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 68917235 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-[(E)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-oxoprop-1-enyl]benzonitrile |
| SMILES | N#Cc1cccc(/C=C/C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H16N2O3/c21-13-17-8-4-7-16(11-17)9-10-19(23)22-18(14-25-20(22)24)12-15-5-2-1-3-6-15/h1-11,18H,12,14H2/b10-9+/t18-/m0/s1 |
| InChIKey | FWYOESNROVWBFX-BBVFFXRHSA-N |
| XLogP | 3.16 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|