C19H15ClFNO3 — CID 138666361
(4S)-4-benzyl-3-[(E)-3-(4-chloro-3-fluorophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 138666361) has the molecular formula C19H15ClFNO3 and a molecular weight of 359.78 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E)-3-(4-chloro-3-fluorophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E)-3-(4-chloro-3-fluorophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138666361 |
| Molecular Formula | C19H15ClFNO3 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (4S)-4-benzyl-3-[(E)-3-(4-chloro-3-fluorophenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(F)c1)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H15ClFNO3/c20-16-8-6-14(11-17(16)21)7-9-18(23)22-15(12-25-19(22)24)10-13-4-2-1-3-5-13/h1-9,11,15H,10,12H2/b9-7+/t15-/m0/s1 |
| InChIKey | PDYHMFHYEKSTAY-HEWZJLJBSA-N |
| XLogP | 4.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|