C20H19NO4S — CID 102459011
(4R)-4-(benzylsulfinylmethyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 102459011) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is (4R)-4-(benzylsulfinylmethyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(benzylsulfinylmethyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102459011 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (4R)-4-(benzylsulfinylmethyl)-3-[(E)-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1ccccc1)N1C(=O)OC[C@@H]1CS(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H19NO4S/c22-19(12-11-16-7-3-1-4-8-16)21-18(13-25-20(21)23)15-26(24)14-17-9-5-2-6-10-17/h1-12,18H,13-15H2/b12-11+/t18-,26?/m1/s1 |
| InChIKey | VMNLZXCEVSKZIY-KIRMFEMZSA-N |
| XLogP | 3.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|