C32H35N5O4S — CID 157018210
(2S,6R)-4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-[(2-phenyl-1,3-oxazol-4-yl)methyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one (PubChem CID 157018210) has the molecular formula C32H35N5O4S and a molecular weight of 585.73 g/mol. Its IUPAC name is (2S,6R)-4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-[(2-phenyl-1,3-oxazol-4-yl)methyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one.
| Compound Name | (2S,6R)-4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-[(2-phenyl-1,3-oxazol-4-yl)methyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
|---|---|
| PubChem CID | 157018210 |
| Molecular Formula | C32H35N5O4S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | (2S,6R)-4-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-10-[(2-phenyl-1,3-oxazol-4-yl)methyl]-15-oxa-4,7,10-triazatricyclo[14.3.1.02,6]icosa-1(20),16,18-trien-8-one |
| SMILES | Cc1nc(C)c(C(=O)N2C[C@@H]3NC(=O)CN(Cc4coc(-c5ccccc5)n4)CCCCOc4cccc(c4)[C@H]3C2)s1 |
| InChI | InChI=1S/C32H35N5O4S/c1-21-30(42-22(2)33-21)32(39)37-17-27-24-11-8-12-26(15-24)40-14-7-6-13-36(19-29(38)35-28(27)18-37)16-25-20-41-31(34-25)23-9-4-3-5-10-23/h3-5,8-12,15,20,27-28H,6-7,13-14,16-19H2,1-2H3,(H,35,38)/t27-,28+/m1/s1 |
| InChIKey | VOVMZVNZLFBTNY-IZLXSDGUSA-N |
| XLogP | 4.81 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |