C23H32N4O2 — CID 42398950
(4aR,8aS)-6-[(1,5-dimethylpyrazol-4-yl)methyl]-1-[2-(4-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 42398950) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (4aR,8aS)-6-[(1,5-dimethylpyrazol-4-yl)methyl]-1-[2-(4-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-[(1,5-dimethylpyrazol-4-yl)methyl]-1-[2-(4-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 42398950 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (4aR,8aS)-6-[(1,5-dimethylpyrazol-4-yl)methyl]-1-[2-(4-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1ccc(CCN2C(=O)CC[C@@H]3CN(Cc4cnn(C)c4C)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C23H32N4O2/c1-17-20(14-24-25(17)2)16-26-12-11-22-19(15-26)6-9-23(28)27(22)13-10-18-4-7-21(29-3)8-5-18/h4-5,7-8,14,19,22H,6,9-13,15-16H2,1-3H3/t19-,22+/m1/s1 |
| InChIKey | YNTYCNNLZFOQKH-KNQAVFIVSA-N |
| XLogP | 2.79 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |