C15H17NOS — CID 11536231
2-phenylsulfanyl-1,6,7,8,9,9a-hexahydroquinolizin-4-one (PubChem CID 11536231) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-phenylsulfanyl-1,6,7,8,9,9a-hexahydroquinolizin-4-one.
| Compound Name | 2-phenylsulfanyl-1,6,7,8,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 11536231 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-phenylsulfanyl-1,6,7,8,9,9a-hexahydroquinolizin-4-one |
| SMILES | O=C1C=C(Sc2ccccc2)CC2CCCCN12 |
| InChI | InChI=1S/C15H17NOS/c17-15-11-14(18-13-7-2-1-3-8-13)10-12-6-4-5-9-16(12)15/h1-3,7-8,11-12H,4-6,9-10H2 |
| InChIKey | UIQFILSYXTVVPP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |