C21H26N2S — CID 101205230
(3aS,7aS)-1,3-dimethyl-2-(2-phenylsulfanylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole (PubChem CID 101205230) has the molecular formula C21H26N2S and a molecular weight of 338.52 g/mol. Its IUPAC name is (3aS,7aS)-1,3-dimethyl-2-(2-phenylsulfanylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole.
| Compound Name | (3aS,7aS)-1,3-dimethyl-2-(2-phenylsulfanylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole |
|---|---|
| PubChem CID | 101205230 |
| Molecular Formula | C21H26N2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (3aS,7aS)-1,3-dimethyl-2-(2-phenylsulfanylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole |
| SMILES | CN1C(c2ccccc2Sc2ccccc2)N(C)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H26N2S/c1-22-18-13-7-8-14-19(18)23(2)21(22)17-12-6-9-15-20(17)24-16-10-4-3-5-11-16/h3-6,9-12,15,18-19,21H,7-8,13-14H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | GOFOMGOJCGQOLS-OALUTQOASA-N |
| XLogP | 5.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |