C24H22N2O3 — CID 142745046
2'-cyclohexylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione (PubChem CID 142745046) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2'-cyclohexylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione.
| Compound Name | 2'-cyclohexylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione |
|---|---|
| PubChem CID | 142745046 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2'-cyclohexylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione |
| SMILES | O=C1NC2(c3ccccc31)c1ccccc1C1C(=O)N(C3CCCCC3)C(=O)C12 |
| InChI | InChI=1S/C24H22N2O3/c27-21-16-11-5-7-13-18(16)24(25-21)17-12-6-4-10-15(17)19-20(24)23(29)26(22(19)28)14-8-2-1-3-9-14/h4-7,10-14,19-20H,1-3,8-9H2,(H,25,27) |
| InChIKey | RTXLQYMGOPXFCL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|