C25H18N2O3 — CID 142745047
2'-benzylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione (PubChem CID 142745047) has the molecular formula C25H18N2O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2'-benzylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione.
| Compound Name | 2'-benzylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione |
|---|---|
| PubChem CID | 142745047 |
| Molecular Formula | C25H18N2O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2'-benzylspiro[2H-isoindole-3,4'-3a,8b-dihydroindeno[1,2-c]pyrrole]-1,1',3'-trione |
| SMILES | O=C1NC2(c3ccccc31)c1ccccc1C1C(=O)N(Cc3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C25H18N2O3/c28-22-17-11-5-7-13-19(17)25(26-22)18-12-6-4-10-16(18)20-21(25)24(30)27(23(20)29)14-15-8-2-1-3-9-15/h1-13,20-21H,14H2,(H,26,28) |
| InChIKey | JREKQGRBTDJXQV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|