C21H21N3O2 — CID 704651
(3S)-3'-cyclohexylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione (PubChem CID 704651) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3S)-3'-cyclohexylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione.
| Compound Name | (3S)-3'-cyclohexylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
|---|---|
| PubChem CID | 704651 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (3S)-3'-cyclohexylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
| SMILES | O=C1c2ccccc2N[C@]2(C(=O)Nc3ccccc32)N1C1CCCCC1 |
| InChI | InChI=1S/C21H21N3O2/c25-19-15-10-4-6-12-17(15)23-21(24(19)14-8-2-1-3-9-14)16-11-5-7-13-18(16)22-20(21)26/h4-7,10-14,23H,1-3,8-9H2,(H,22,26)/t21-/m0/s1 |
| InChIKey | SPGKWGZJJHKEHU-NRFANRHFSA-N |
| XLogP | 3.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |