C16H20N2O2 — CID 82937150
1-cyclopentyl-3,3-dimethyl-4H-1,4-benzodiazepine-2,5-dione (PubChem CID 82937150) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-cyclopentyl-3,3-dimethyl-4H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 1-cyclopentyl-3,3-dimethyl-4H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 82937150 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-cyclopentyl-3,3-dimethyl-4H-1,4-benzodiazepine-2,5-dione |
| SMILES | CC1(C)NC(=O)c2ccccc2N(C2CCCC2)C1=O |
| InChI | InChI=1S/C16H20N2O2/c1-16(2)15(20)18(11-7-3-4-8-11)13-10-6-5-9-12(13)14(19)17-16/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,17,19) |
| InChIKey | DORTWYBNPBAXRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |