C16H19NO2 — CID 141035211
3,3-dimethyl-1-(3-oxocyclohexyl)indol-2-one (PubChem CID 141035211) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-oxocyclohexyl)indol-2-one.
| Compound Name | 3,3-dimethyl-1-(3-oxocyclohexyl)indol-2-one |
|---|---|
| PubChem CID | 141035211 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3,3-dimethyl-1-(3-oxocyclohexyl)indol-2-one |
| SMILES | CC1(C)C(=O)N(C2CCCC(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C16H19NO2/c1-16(2)13-8-3-4-9-14(13)17(15(16)19)11-6-5-7-12(18)10-11/h3-4,8-9,11H,5-7,10H2,1-2H3 |
| InChIKey | ZGQCCRKKGRLTIW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |