C16H22N2O — CID 82623639
1-[2-(aminomethyl)phenyl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one (PubChem CID 82623639) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one.
| Compound Name | 1-[2-(aminomethyl)phenyl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 82623639 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]-1,2,5,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-3-one |
| SMILES | NCc1ccccc1C1CC(=O)N2CCCCCC12 |
| InChI | InChI=1S/C16H22N2O/c17-11-12-6-3-4-7-13(12)14-10-16(19)18-9-5-1-2-8-15(14)18/h3-4,6-7,14-15H,1-2,5,8-11,17H2 |
| InChIKey | KBKKTPVNBMCXLY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |