3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid

C15H17NO3 — CID 82623748

IUPAC3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid
SMILESO=C(O)c1cccc(C2CC(=O)N3CCCCC23)c1
InChIInChI=1S/C15H17NO3/c17-14-9-12(13-6-1-2-7-16(13)14)10-4-3-5-11(8-10)15(18)19/h3-5,8,12-13H,1-2,6-7,9H2,(H,18,19)
InChIKeyCXGZNSROSVIPSM-UHFFFAOYSA-N
MW259.30 g/mol
LogP2.25
Rot. Bonds2

About 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid

3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid (PubChem CID 82623748) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid.

Molecular Properties

Compound Name3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid
PubChem CID82623748
Molecular FormulaC15H17NO3
Molecular Weight259.30 g/mol
Exact Mass259.12
IUPAC Name3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid
SMILESO=C(O)c1cccc(C2CC(=O)N3CCCCC23)c1
InChIInChI=1S/C15H17NO3/c17-14-9-12(13-6-1-2-7-16(13)14)10-4-3-5-11(8-10)15(18)19/h3-5,8,12-13H,1-2,6-7,9H2,(H,18,19)
InChIKeyCXGZNSROSVIPSM-UHFFFAOYSA-N
XLogP2.25
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.30
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid?
The IUPAC name of 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid (CID 82623748) is 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid.
What is the SMILES notation for 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid?
The canonical SMILES for 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid is O=C(O)c1cccc(C2CC(=O)N3CCCCC23)c1.
What is the InChIKey of 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid?
The InChIKey is CXGZNSROSVIPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c17-14-9-12(13-6-1-2-7-16(13)14)10-4-3-5-11(8-10)15(18)19/h3-5,8,12-13H,1-2,6-7,9H2,(H,18,19).
What are the key properties of 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid?
3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid has a molecular weight of 259.30 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid is sourced from PubChem (CID 82623748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).