C15H17NO3 — CID 82623748
3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid (PubChem CID 82623748) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid.
| Compound Name | 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 82623748 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(C2CC(=O)N3CCCCC23)c1 |
| InChI | InChI=1S/C15H17NO3/c17-14-9-12(13-6-1-2-7-16(13)14)10-4-3-5-11(8-10)15(18)19/h3-5,8,12-13H,1-2,6-7,9H2,(H,18,19) |
| InChIKey | CXGZNSROSVIPSM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |