C21H22N2O3 — CID 122031637
3-[[[5-oxo-1-(2-phenylcyclopropyl)pyrrolidin-3-yl]amino]methyl]benzoic acid (PubChem CID 122031637) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[[[5-oxo-1-(2-phenylcyclopropyl)pyrrolidin-3-yl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[5-oxo-1-(2-phenylcyclopropyl)pyrrolidin-3-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031637 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[[[5-oxo-1-(2-phenylcyclopropyl)pyrrolidin-3-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNC2CC(=O)N(C3CC3c3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H22N2O3/c24-20-10-17(22-12-14-5-4-8-16(9-14)21(25)26)13-23(20)19-11-18(19)15-6-2-1-3-7-15/h1-9,17-19,22H,10-13H2,(H,25,26) |
| InChIKey | KRHNFHMZONWHBQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |