C14H16N2O2 — CID 122129337
3-[[[(1R,3S)-3-cyanocyclopentyl]amino]methyl]benzoic acid (PubChem CID 122129337) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-[[[(1R,3S)-3-cyanocyclopentyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[(1R,3S)-3-cyanocyclopentyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122129337 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-[[[(1R,3S)-3-cyanocyclopentyl]amino]methyl]benzoic acid |
| SMILES | N#C[C@H]1CC[C@@H](NCc2cccc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C14H16N2O2/c15-8-10-4-5-13(7-10)16-9-11-2-1-3-12(6-11)14(17)18/h1-3,6,10,13,16H,4-5,7,9H2,(H,17,18)/t10-,13+/m0/s1 |
| InChIKey | AEMBPYCEPCOTSI-GXFFZTMASA-N |
| XLogP | 2.17 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |